| Sonrisas canónicas | C1=C(C=NC(=C1[N+](=O)[O-])I)Cl |
|---|---|
| IUPAC Name | 5-chloro-2-iodo-3-nitropyridine |
| InChIKey | UXJODOZORLBGIZ-UHFFFAOYSA-N |
| INCHI | 1S/C5H2ClIN2O2/c6-3-1-4(9(10)11)5(7)8-2-3/h1-2H |
| Peso molecular | 284.44 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic 1,3-dipolar compounds |
| Clase | Allyl-type 1,3-dipolar organic compounds |
| Subclass | Organic nitro compounds |
| Intermediate Tree Nodes | C-nitro compounds |
| Direct Parent | Nitroaromatic compounds |
| Alternative Parents | Polyhalopyridines 2-halopyridines Heteroaromatic compounds Imidoyl iodides Vinyl chlorides Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Chloroalkenes Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organoiodides Organochlorides Organic oxoanionic compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Nitroaromatic compound - Polyhalopyridine - 2-halopyridine - Pyridine - Heteroaromatic compound - Imidoyl iodide - Imidoyl halide - Azacycle - Chloroalkene - Haloalkene - Organoheterocyclic compound - Propargyl-type 1,3-dipolar organic compound - Vinyl halide - Vinyl chloride - Organic oxoazanium - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organonitrogen compound - Organoiodide - Organochloride - Organic hyponitrite - Organohalogen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as nitroaromatic compounds. These are c-nitro compounds where the nitro group is C-substituted with an aromatic group. |
| External Descriptors | Not available |
| Peso molecular | 284.440 g/mol |
|---|---|
| XLogP3 | 2.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 283.885 Da |
| Monoisotopic Mass | 283.885 Da |
| Topological Polar Surface Area | 58.700 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 163.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
