| Sonrisas canónicas | C1=CC(=CC=C1OC2=NC=C(C=C2)CO)Cl |
|---|---|
| IUPAC Name | [6-(4-chlorophenoxy)pyridin-3-yl]methanol |
| InChIKey | OYZUUNVPQAVBJW-UHFFFAOYSA-N |
| INCHI | 1S/C12H10ClNO2/c13-10-2-4-11(5-3-10)16-12-6-1-9(8-15)7-14-12/h1-7,15H,8H2 |
| Isómeros SMILES | C1=CC(=CC=C1OC2=NC=C(C=C2)CO)Cl |
| PubChem CID | 61256507 |
| Peso molecular | 235.66 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Phenol ethers |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol ethers |
| Alternative Parents | Polyhalopyridines Hydroxypyridines Chlorobenzenes 2-halopyridines Heteroaromatic compounds Vinyl chlorides Propargyl-type 1,3-dipolar organic compounds Ethers Chloroalkenes Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Polyhalopyridine - Phenol ether - 2-halopyridine - Hydroxypyridine - Halobenzene - Chlorobenzene - Pyridine - Monocyclic benzene moiety - Heteroaromatic compound - Azacycle - Chloroalkene - Haloalkene - Organoheterocyclic compound - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Vinyl halide - Vinyl chloride - Ether - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Aromatic alcohol - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Alcohol - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. |
| External Descriptors | Not available |
| Peso molecular | 235.660 g/mol |
|---|---|
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 235.04 Da |
| Monoisotopic Mass | 235.04 Da |
| Topological Polar Surface Area | 42.400 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 207.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![[6-(4-Chlorophenoxy)pyridin-3-yl]methanol - ≥95% , CAS No.1160430-78-3](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)