Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCN1C(=NNC1=S)COC2=NN(C(=O)C=C2)C3=CC=CC=C3 |
|---|---|
| IUPAC Name | 6-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]-2-phenylpyridazin-3-one |
| InChIKey | TWTUWKBNPUWORE-UHFFFAOYSA-N |
| INCHI | 1S/C15H15N5O2S/c1-2-19-12(16-17-15(19)23)10-22-13-8-9-14(21)20(18-13)11-6-4-3-5-7-11/h3-9H,2,10H2,1H3,(H,17,23) |
| Isómeros SMILES | CCN1C(=NNC1=S)COC2=NN(C(=O)C=C2)C3=CC=CC=C3 |
| PubChem CID | 3724296 |
| Peso molecular | 329.38 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Diazines |
| Subclass | Pyridazines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridazinones |
| Alternative Parents | Alkyl aryl ethers Benzene and substituted derivatives Triazoles Heteroaromatic compounds Lactams Azacyclic compounds Organosulfur compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkyl aryl ether - Pyridazinone - Monocyclic benzene moiety - Benzenoid - Azole - 1,2,4-triazole - Heteroaromatic compound - Lactam - Ether - Azacycle - Organic oxide - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as pyridazinones. These are compounds containing a pyridazine ring which bears a ketone. |
| External Descriptors | Not available |
| Peso molecular | 329.400 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 5 |
| Exact Mass | 329.095 Da |
| Monoisotopic Mass | 329.095 Da |
| Topological Polar Surface Area | 102.000 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 580.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |