Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=C2C(=C(N=C1Br)Cl)N=CN2 |
|---|---|
| IUPAC Name | 6-bromo-4-chloro-1H-imidazo[4,5-c]pyridine |
| InChIKey | BKEMPCSUWXUOMM-UHFFFAOYSA-N |
| INCHI | 1S/C6H3BrClN3/c7-4-1-3-5(6(8)11-4)10-2-9-3/h1-2H,(H,9,10) |
| Isómeros SMILES | C1=C2C(=C(N=C1Br)Cl)N=CN2 |
| PubChem CID | 90456846 |
| Peso molecular | 232.47 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Imidazopyridines |
| Subclass | Imidazo-[4,5-c]pyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Imidazo-[4,5-c]pyridines |
| Alternative Parents | Polyhalopyridines 2-halopyridines Aryl chlorides Aryl bromides Imidazoles Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Imidazo-[4,5-c]pyridine - Polyhalopyridine - 2-halopyridine - Aryl bromide - Aryl chloride - Aryl halide - Pyridine - Heteroaromatic compound - Azole - Imidazole - Azacycle - Organohalogen compound - Organochloride - Organonitrogen compound - Hydrocarbon derivative - Organic nitrogen compound - Organobromide - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as imidazo-[4,5-c]pyridines. These are organic heterocyclic compounds containing an imidazo-[4,5-c]pyridine ring system. Imidazo-[4,5-c]pyridine consists of an imidazole ring fused to a pyridine, so that the three ring nitrogen atoms are at the 1-, 2-, and 5-position, respectively. |
| External Descriptors | Not available |
| Peso molecular | 232.460 g/mol |
|---|---|
| XLogP3 | 2.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 230.92 Da |
| Monoisotopic Mass | 230.92 Da |
| Topological Polar Surface Area | 41.600 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 157.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |