Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1C(C2=C(C=CC(=C2)Br)OC1=O)C3=CC=CC=C3 |
|---|---|
| IUPAC Name | 6-bromo-4-phenyl-3,4-dihydrochromen-2-one |
| InChIKey | KFKFQGCDFMGUCH-UHFFFAOYSA-N |
| INCHI | 1S/C15H11BrO2/c16-11-6-7-14-13(8-11)12(9-15(17)18-14)10-4-2-1-3-5-10/h1-8,12H,9H2 |
| Isómeros SMILES | C1C(C2=C(C=CC(=C2)Br)OC1=O)C3=CC=CC=C3 |
| CAS alternativo | 156755-23-6 |
| PubChem CID | 2924973 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Phenylpropanoids and polyketides |
| Clase | Neoflavonoids |
| Subclass | Neoflavans |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Neoflavans |
| Alternative Parents | 3,4-dihydrocoumarins 1-benzopyrans Benzene and substituted derivatives Aryl bromides Lactones Carboxylic acid esters Oxacyclic compounds Monocarboxylic acids and derivatives Organobromides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Neoflavan - 3,4-dihydrocoumarin - Chromane - Benzopyran - 1-benzopyran - Benzenoid - Aryl bromide - Aryl halide - Monocyclic benzene moiety - Carboxylic acid ester - Lactone - Monocarboxylic acid or derivatives - Oxacycle - Carboxylic acid derivative - Organoheterocyclic compound - Hydrocarbon derivative - Carbonyl group - Organic oxygen compound - Organobromide - Organooxygen compound - Organic oxide - Organohalogen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as neoflavans. These are neoflavonoids with a structure based on a 3,4-dihydro-4-aryl-2H-1-benzopyran skeleton. |
| External Descriptors | Not available |
| Peso molecular | 303.150 g/mol |
|---|---|
| XLogP3 | 3.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 301.994 Da |
| Monoisotopic Mass | 301.994 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 312.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |