Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC(=C(C=C1NC2=NC(=NC(=N2)N)CCl)Cl)Cl |
|---|---|
| IUPAC Name | 6-(chloromethyl)-2-N-(3,4-dichlorophenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | BVXIQAHVNCQTQC-UHFFFAOYSA-N |
| INCHI | 1S/C10H8Cl3N5/c11-4-8-16-9(14)18-10(17-8)15-5-1-2-6(12)7(13)3-5/h1-3H,4H2,(H3,14,15,16,17,18) |
| Isómeros SMILES | C1=CC(=C(C=C1NC2=NC(=NC(=N2)N)CCl)Cl)Cl |
| CAS alternativo | 644959-94-4 |
| PubChem CID | 931811 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Chlorobenzenes |
| Direct Parent | Dichlorobenzenes |
| Alternative Parents | Aniline and substituted anilines 1,3,5-triazine-2,4-diamines Aryl chlorides 1,3,5-triazines Heteroaromatic compounds Secondary amines Azacyclic compounds Primary amines Organopnictogen compounds Organochlorides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2,4-diamine-s-triazine - Aniline or substituted anilines - 1,2-dichlorobenzene - Amino-1,3,5-triazine - Aminotriazine - Aryl chloride - Aryl halide - 1,3,5-triazine - Triazine - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Secondary amine - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Hydrocarbon derivative - Organopnictogen compound - Organic nitrogen compound - Organonitrogen compound - Primary amine - Amine - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as dichlorobenzenes. These are compounds containing a benzene with exactly two chlorine atoms attached to it. |
| External Descriptors | Not available |
| Peso molecular | 304.600 g/mol |
|---|---|
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 302.985 Da |
| Monoisotopic Mass | 302.985 Da |
| Topological Polar Surface Area | 76.700 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 270.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |