Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C,Argon charged Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Description
6-Chloronicotinoyl chloride undergoes esterification reaction with diethylene glycol and pentaethylene glycol.6-Chloronicotinoyl chloride may be used to synthesize:[3H]imidacloprid (a candidate radioligand)[3H]acetamipridN,N′-(1,4-phenylene)bis(6-(4-aminophenoxy) nicotinamide)3-acetyl-6-chloropyridine1,3-dipropyl-8(6-chloro-3-pyridyl)xanthine
| Sonrisas canónicas | C1=CC(=NC=C1C(=O)Cl)Cl.Cl |
|---|---|
| IUPAC Name | 6-chloropyridine-3-carbonyl chloride;hydrochloride |
| InChIKey | NGDJIWMBLGYWEG-UHFFFAOYSA-N |
| INCHI | 1S/C6H3Cl2NO.ClH/c7-5-2-1-4(3-9-5)6(8)10;/h1-3H;1H |
| Isómeros SMILES | C1=CC(=NC=C1C(=O)Cl)Cl.Cl |
| PubChem CID | 18548589 |
| Número ONU | 3261 |
| Peso molecular | 212.5 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Pyridines and derivatives |
| Subclass | Pyridinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridinecarboxylic acids and derivatives |
| Alternative Parents | 2-halopyridines Aryl chlorides Heteroaromatic compounds Azacyclic compounds Acyl chlorides Organooxygen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridine carboxylic acid or derivatives - 2-halopyridine - Aryl chloride - Aryl halide - Heteroaromatic compound - Azacycle - Acyl halide - Acyl chloride - Hydrocarbon derivative - Hydrochloride - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic oxide - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as pyridinecarboxylic acids and derivatives. These are compounds containing a pyridine ring bearing a carboxylic acid group or a derivative thereof. |
| External Descriptors | Not available |
| Peso molecular | 212.500 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 210.936 Da |
| Monoisotopic Mass | 210.936 Da |
| Topological Polar Surface Area | 30.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 140.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |