Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1CCN(CC1)C2=CC=CC(=N2)CN |
|---|---|
| IUPAC Name | (6-piperidin-1-ylpyridin-2-yl)methanamine |
| InChIKey | AMSLKMQNMJEDRH-UHFFFAOYSA-N |
| INCHI | 1S/C11H17N3/c12-9-10-5-4-6-11(13-10)14-7-2-1-3-8-14/h4-6H,1-3,7-9,12H2 |
| Isómeros SMILES | C1CCN(CC1)C2=CC=CC(=N2)CN |
| PubChem CID | 18525734 |
| Peso molecular | 191.27 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Pyridines and derivatives |
| Subclass | 2-pyridylmethylamines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 6-substituted-2-pyridinylmethylamines |
| Alternative Parents | Dialkylarylamines Aralkylamines Aminopyridines and derivatives Piperidines Imidolactams Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 6-substituted-2-pyridinylmethylamine - Dialkylarylamine - Aminopyridine - Aralkylamine - Piperidine - Imidolactam - Heteroaromatic compound - Azacycle - Amine - Hydrocarbon derivative - Primary amine - Organopnictogen compound - Organonitrogen compound - Primary aliphatic amine - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as 6-substituted-2-pyridinylmethylamines. These are aromatic heterocyclic compounds contaning a pyridine ring which is substituted at the 2-position with a methylamine, and at the 6-position with any non-hydrogen atom. |
| External Descriptors | Not available |
| Peso molecular | 191.270 g/mol |
|---|---|
| XLogP3 | 1.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 191.142 Da |
| Monoisotopic Mass | 191.142 Da |
| Topological Polar Surface Area | 42.200 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 166.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |