Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1C2=C(C=CC(=C2F)F)C(C3=CC=CC=C3S1)O |
|---|---|
| IUPAC Name | 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol |
| InChIKey | OBEXFUFBCNVOKB-UHFFFAOYSA-N |
| INCHI | 1S/C14H10F2OS/c15-11-6-5-8-10(13(11)16)7-18-12-4-2-1-3-9(12)14(8)17/h1-6,14,17H,7H2 |
| Isómeros SMILES | C1C2=C(C=CC(=C2F)F)C(C3=CC=CC=C3S1)O |
| Peso molecular | 264.29 |
| Reaxy-Rn | 30163465 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=30163465&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Benzothiepins |
| Subclass | Dibenzothiepins |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dibenzothiepins |
| Alternative Parents | Thiepanes Alkylarylthioethers Benzenoids Thioenol ethers Secondary alcohols Vinyl fluorides Sulfenyl compounds Fluoroalkenes Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Dibenzothiepin - Aryl thioether - Alkylarylthioether - Thiepane - Benzenoid - Thioenolether - Secondary alcohol - Fluoroalkene - Haloalkene - Sulfenyl compound - Vinyl halide - Vinyl fluoride - Thioether - Organic oxygen compound - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organofluoride - Organohalogen compound - Alcohol - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as dibenzothiepins. These are compounds containing a dibenzothiepin moiety, which consists of two benzene connected by a thiepine ring. |
| External Descriptors | Not available |
| Peso molecular | 264.290 g/mol |
|---|---|
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 264.042 Da |
| Monoisotopic Mass | 264.042 Da |
| Topological Polar Surface Area | 45.500 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 302.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |