Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | COC1=C(C(=C(C2=C1COC2=O)CCl)OC)OC |
|---|---|
| IUPAC Name | 7-(chloromethyl)-4,5,6-trimethoxy-3H-2-benzofuran-1-one |
| InChIKey | UNZNABLCQIHCLL-UHFFFAOYSA-N |
| INCHI | 1S/C12H13ClO5/c1-15-9-6(4-13)8-7(5-18-12(8)14)10(16-2)11(9)17-3/h4-5H2,1-3H3 |
| Isómeros SMILES | COC1=C(C(=C(C2=C1COC2=O)CCl)OC)OC |
| CAS alternativo | 6547-34-8 |
| PubChem CID | 329484 |
| Número NSC | 312617 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Hydroxybenzoic acid derivatives |
| Direct Parent | Gallic acid and derivatives |
| Alternative Parents | Phthalides Anisoles Alkyl aryl ethers Lactones Carboxylic acid esters Oxacyclic compounds Organochlorides Organic oxides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Gallic acid or derivatives - Isobenzofuranone - Phthalide - Isocoumaran - Anisole - Phenol ether - Alkyl aryl ether - Carboxylic acid ester - Lactone - Carboxylic acid derivative - Ether - Oxacycle - Organoheterocyclic compound - Alkyl halide - Alkyl chloride - Hydrocarbon derivative - Organic oxygen compound - Organic oxide - Organohalogen compound - Organochloride - Organooxygen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as gallic acid and derivatives. These are compounds containing a 3,4,5-trihydroxybenzoic acid moiety. |
| External Descriptors | Not available |
| Peso molecular | 272.680 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Exact Mass | 272.045 Da |
| Monoisotopic Mass | 272.045 Da |
| Topological Polar Surface Area | 54.000 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 311.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |