Determine the necessary mass, volume, or concentration for preparing a solution.
≥96% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488181436 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488181436 |
| Sonrisas canónicas | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2Cl)Cl |
| IUPAC Name | 9,10-dichloroanthracene |
| InChIKey | FKDIWXZNKAZCBY-UHFFFAOYSA-N |
| INCHI | 1S/C14H8Cl2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8H |
| Isómeros SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2Cl)Cl |
| Peso molecular | 247.12 |
| Beilstein | 1912108 |
| Reaxy-Rn | 1912108 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1912108&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Anthracenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anthracenes |
| Alternative Parents | Chloronaphthalenes Aryl chlorides Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Anthracene - Chloronaphthalene - Aryl halide - Aryl chloride - Hydrocarbon derivative - Organochloride - Organohalogen compound - Aromatic homopolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as anthracenes. These are organic compounds containing a system of three linearly fused benzene rings. |
| External Descriptors | Not available |
| Punto de fusión (°C) | 210-215°C |
|---|---|
| Peso molecular | 247.100 g/mol |
| XLogP3 | 5.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 246 Da |
| Monoisotopic Mass | 246 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 203.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Yun Luo, Ningbo Geng, Shuai Sun, Lin Cheng, Shuangshuang Chen, Haijun Zhang, Jiping Chen. (2023) Integration approach of transcriptomics and metabolomics reveals the toxicity of Anthracene and its chlorinated derivatives on human hepatic cells. SCIENCE OF THE TOTAL ENVIRONMENT, [PMID:37678537] [10.1016/j.scitotenv.2023.166886] |
| 2. Bolin Mou, Shimin Wu. (2025) Investigation on the interaction mechanism of phospholipids with polycyclic aromatic hydrocarbons and their derivatives during oil degumming process. FOOD CHEMISTRY, [PMID:40997413] [10.1016/j.foodchem.2025.146495] |