Determine the necessary mass, volume, or concentration for preparing a solution.
≥96% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488198429 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488198429 |
| Sonrisas canónicas | CC(=O)N1C2=C(C=C(C=C2)I)C3=C1C=CC(=C3)I |
| IUPAC Name | 1-(3,6-diiodocarbazol-9-yl)ethanone |
| InChIKey | HAZMJWKYEJRBCO-UHFFFAOYSA-N |
| INCHI | 1S/C14H9I2NO/c1-8(18)17-13-4-2-9(15)6-11(13)12-7-10(16)3-5-14(12)17/h2-7H,1H3 |
| Isómeros SMILES | CC(=O)N1C2=C(C=C(C=C2)I)C3=C1C=CC(=C3)I |
| Peso molecular | 461.04 |
| Beilstein | 20449 |
| Reaxy-Rn | 205686 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=205686&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Indoles and derivatives |
| Subclass | Carbazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | N-acylcarbazoles |
| Alternative Parents | Indoles Substituted pyrroles Benzenoids Aryl iodides Heteroaromatic compounds Acetamides Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organoiodides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | N-acylcarbazole - Indole - Aryl halide - Aryl iodide - Substituted pyrrole - Benzenoid - Pyrrole - Heteroaromatic compound - Acetamide - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organoiodide - Organohalogen compound - Organopnictogen compound - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as n-acylcarbazoles. These are aromatic heteropolycyclic compounds containing a carbazole moiety, which is N-acylated. |
| External Descriptors | Not available |
| Solubilidad | Soluble in Tetrahydrofuran |
|---|---|
| Sensibilidad | Light Sensitive |
| Punto de fusión (°C) | 228 °C |
| Peso molecular | 461.040 g/mol |
| XLogP3 | 4.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 460.877 Da |
| Monoisotopic Mass | 460.877 Da |
| Topological Polar Surface Area | 22.000 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 323.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |