≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC(=CC=C1C(C2=CC=C(C=C2)F)S(=O)CC(=O)N)F |
|---|---|
| IUPAC Name | 2-[bis(4-fluorophenyl)methylsulfinyl]acetamide |
| InChIKey | YEAQNUMCWMRYMU-UHFFFAOYSA-N |
| INCHI | 1S/C15H13F2NO2S/c16-12-5-1-10(2-6-12)15(21(20)9-14(18)19)11-3-7-13(17)8-4-11/h1-8,15H,9H2,(H2,18,19) |
| Isómeros SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)F)S(=O)CC(=O)N)F |
| CAS alternativo | 90280-13-0 |
| PubChem CID | 13271852 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Diphenylmethanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diphenylmethanes |
| Alternative Parents | Benzyl alkyl sulfoxides Fluorobenzenes Aryl fluorides Sulfoxides Primary carboxylic acid amides Sulfinyl compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Diphenylmethane - Benzyl alkyl sulfoxide - Benzyl sulfoxide - Fluorobenzene - Halobenzene - Aryl fluoride - Aryl halide - Carboxamide group - Sulfoxide - Primary carboxylic acid amide - Carboxylic acid derivative - Sulfinyl compound - Organofluoride - Organohalogen compound - Organosulfur compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organic oxygen compound - Organonitrogen compound - Organooxygen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as diphenylmethanes. These are compounds containing a diphenylmethane moiety, which consists of a methane wherein two hydrogen atoms are replaced by two phenyl groups. |
| External Descriptors | Not available |
| Peso molecular | 309.300 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 5 |
| Exact Mass | 309.064 Da |
| Monoisotopic Mass | 309.064 Da |
| Topological Polar Surface Area | 79.400 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 356.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![Acetamide, 2-[[bis(4-fluorophenyl)methyl]sulfinyl]- - ≥99% CAS No(90280-13-0) by Aladdin Scientific](https://www.aladdinsci.com/media/catalog/product/cache/207e23213cf636ccdef205098cf3c8a3/A/1/A1342296.jpg)