Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Acid-PEG2-SS-PEG2-acid is a cleavable PEG linker with carboxylic acid groups at both terminus. The disulfide bonds can be cleaved via a reduction reaction using Dithiothreitol (DTT) reagent. The terminal carboxylic acids can be reacted with primary amines in the presences of activators such as EDC and DCC to form stable amide bonds. The hydrophilic PEG linkers can increase the water solubility of the compound in aqueous media.
| Sonrisas canónicas | C(COCCOCCSSCCOCCOCCC(=O)O)C(=O)O |
|---|---|
| IUPAC Name | 3-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethyldisulfanyl]ethoxy]ethoxy]propanoic acid |
| InChIKey | TZKZHEPGHNBGKD-UHFFFAOYSA-N |
| INCHI | 1S/C14H26O8S2/c15-13(16)1-3-19-5-7-21-9-11-23-24-12-10-22-8-6-20-4-2-14(17)18/h1-12H2,(H,15,16)(H,17,18) |
| Isómeros SMILES | C(COCCOCCSSCCOCCOCCC(=O)O)C(=O)O |
| PubChem CID | 91809454 |
| Peso molecular | 386.5 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Dicarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dicarboxylic acids and derivatives |
| Alternative Parents | Dialkyldisulfides Sulfenyl compounds Dialkyl ethers Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Dicarboxylic acid or derivatives - Dialkyldisulfide - Organic disulfide - Sulfenyl compound - Ether - Dialkyl ether - Carboxylic acid - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as dicarboxylic acids and derivatives. These are organic compounds containing exactly two carboxylic acid groups. |
| External Descriptors | Not available |
| Solubilidad | Solubility in Water, DMSO, DCM, DMF |
|---|---|
| Peso molecular | 386.500 g/mol |
| XLogP3 | -0.700 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 19 |
| Exact Mass | 386.107 Da |
| Monoisotopic Mass | 386.107 Da |
| Topological Polar Surface Area | 162.000 Ų |
| Heavy Atom Count | 24 |
| Formal Charge | 0 |
| Complexity | 287.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |