Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(HPLC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
A potent hepatotoxic and hepatocarcinogenic mycotoxin, found in milk of cows fed on meal contaminated with aflatoxin B2
Potent liver carcinogen and DNA-damaging agent. It is also mutagenic, teratogenic, and causes immunosuppression in animals.
| Sonrisas canónicas | COC1=C2C3=C(C(=O)CC3)C(=O)OC2=C4C(=C1)OC5C4(CCO5)O |
|---|---|
| IUPAC Name | 3-hydroxy-11-methoxy-6,8,19-trioxapentacyclo[10.7.0.02,9.03,7.013,17]nonadeca-1,9,11,13(17)-tetraene-16,18-dione |
| InChIKey | OQLKWHFMUPJCJY-UHFFFAOYSA-N |
| INCHI | 1S/C17H14O7/c1-21-9-6-10-13(17(20)4-5-22-16(17)23-10)14-12(9)7-2-3-8(18)11(7)15(19)24-14/h6,16,20H,2-5H2,1H3 |
| Isómeros SMILES | COC1=C2C3=C(C(=O)CC3)C(=O)OC2=C4C(=C1)OC5C4(CCO5)O |
| Peso molecular | 330.29 |
| Reaxy-Rn | 1440986 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1440986&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Phenylpropanoids and polyketides |
| Clase | Coumarins and derivatives |
| Subclass | Furanocoumarins |
| Intermediate Tree Nodes | Angular furanocoumarins - Aflatoxins |
| Direct Parent | Difurocoumarocyclopentenones |
| Alternative Parents | Difurocoumarins 1-benzopyrans Coumarans Aryl alkyl ketones Anisoles Pyranones and derivatives Alkyl aryl ethers Tetrahydrofurans Tertiary alcohols Heteroaromatic compounds Lactones Oxacyclic compounds Acetals Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Difurocoumarocyclopentenone - Difurocoumarin - Benzopyran - 1-benzopyran - Coumaran - Anisole - Aryl ketone - Aryl alkyl ketone - Alkyl aryl ether - Pyranone - Benzenoid - Pyran - Heteroaromatic compound - Tetrahydrofuran - Tertiary alcohol - Ketone - Lactone - Oxacycle - Ether - Acetal - Organoheterocyclic compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Alcohol - Organooxygen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as difurocoumarocyclopentenones. These are polycyclic aromatic compounds containing a cyclopenten-2-one ring fused to the coumarin moiety of the difurocoumarin skeleton. |
| External Descriptors | Not available |
| Solubilidad | DMSO or MeOH, DMSO or MeOH |
|---|---|
| Sensibilidad | Moisture sensitive;Light sensitive |
| Peso molecular | 330.290 g/mol |
| XLogP3 | 0.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 1 |
| Exact Mass | 330.074 Da |
| Monoisotopic Mass | 330.074 Da |
| Topological Polar Surface Area | 91.300 Ų |
| Heavy Atom Count | 24 |
| Formal Charge | 0 |
| Complexity | 655.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Chong Cai, Qi Zhang, Seyni Nidiaye, Honglin Yan, Wen Zhang, Xiaoqian Tang, Peiwu Li. (2021) Development of a specific anti-idiotypic nanobody for monitoring aflatoxin M1 in milk and dairy products. MICROCHEMICAL JOURNAL, [PMID:] [10.1016/j.microc.2021.106326] |