Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 6 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC=C(C=C1)N.C1=CC=C(C=C1)N.OS(=O)(=O)O |
|---|---|
| IUPAC Name | aniline;sulfuric acid |
| InChIKey | FUKMEFZGEMVGLD-UHFFFAOYSA-N |
| INCHI | 1S/2C6H7N.H2O4S/c2*7-6-4-2-1-3-5-6;1-5(2,3)4/h2*1-5H,7H2;(H2,1,2,3,4) |
| Isómeros SMILES | C1=CC=C(C=C1)N.C1=CC=C(C=C1)N.OS(=O)(=O)O |
| WGK Alemania | 3 |
| Número ONU | 2811 |
| Peso molecular | 284.33 |
| Beilstein | 3729533 |
| Reaxy-Rn | 3917530 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3917530&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Aniline and substituted anilines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aniline and substituted anilines |
| Alternative Parents | Primary amines Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Not available |
| Substituents | Aniline or substituted anilines - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Amine - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as aniline and substituted anilines. These are organic compounds containing an aminobenzene moiety. |
| External Descriptors | Not available |
| Sensibilidad | Light sensitive. |
|---|---|
| Punto de ebullición (°C) | 400~401°C |
| Punto de fusión (°C) | 128°C |
| Peso molecular | 284.330 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 0 |
| Exact Mass | 284.083 Da |
| Monoisotopic Mass | 284.083 Da |
| Topological Polar Surface Area | 135.000 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 127.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
| 1. Huang Jiali, Dong Ruirui, Habibul Marhaba, Zhang Yanhui, Guan Ming, Li Guixin. (2023) An electrochemiluminescence aptasensor based on poly(aniline-luminol)/graphene oxide/chitosan for ultra-sensitive detection of Hg2+. POLYMER BULLETIN, [PMID:] [10.1007/s00289-023-04687-8] |
| 2. Ruirui Dong, Yanhui Zhang, Jiali Huang, Marhaba Habibul, Guixin Li. (2022) Electrochemiluminescence DNA Biosensor for HBV Based on Coralloid Poly(Aniline-Luminol)-MWCNTs and Catalysis of Ferrocene. ELECTROANALYSIS, 34 (10): (1555-1563). [PMID:] [10.1002/elan.202200020] |
| 3. Wei Lu, Zhang Yanhui, Eziz Nurguzal, Yang Yaru, Li Guixin, Guan Ming. (2019) An ultrasensitive electrochemiluminescence immunosensor for alpha-fetoprotein based on a poly(aniline-luminol)/graphene oxide nanocomposite. ANALYTICAL AND BIOANALYTICAL CHEMISTRY, 411 (20): (5175-5186). [PMID:31187200] [10.1007/s00216-019-01897-w] |
| 4. Yaru Yang, Yanhui Zhang, Lu Wei, Guixin Li, Ming Guan, Shuge Tian. (2019) A Highly Sensitive Electrochemiluminescence Choline Biosensor Based on Poly(aniline-luminol-hemin) Nanocomposites. ELECTROANALYSIS, 31 (4): (624-631). [PMID:] [10.1002/elan.201800582] |
| 5. Xinxing Zhou, Yunzhi Xu, Xiaojie Mei, Ningjie Du, Rongmao Jv, Zhaoxia Hu, Shouwen Chen. (2018) Polyaniline/β-MnO2 nanocomposites as cathode electrocatalyst for oxygen reduction reaction in microbial fuel cells. CHEMOSPHERE, [PMID:29427950] [10.1016/j.chemosphere.2018.01.058] |
| 6. Jiali Ju, Qiaoyu Ding, Jianwei Xie, Guixin Li. (2024) Label-free electrochemiluminescence immunosensor for mucoprotein 1 using a graphene oxide-Ru(Bpy)32+-polyaniline nanocomposite. ANALYTICAL LETTERS, [PMID:] [10.1080/00032719.2023.2209679] |