Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CN(C)CCC1=CC(=C(C2=C1C=CC3=CC=CC=C32)OC)OC |
|---|---|
| IUPAC Name | 2-(3,4-dimethoxyphenanthren-1-yl)-N,N-dimethylethanamine |
| InChIKey | UZZFAUDNCIFFPM-UHFFFAOYSA-N |
| INCHI | 1S/C20H23NO2/c1-21(2)12-11-15-13-18(22-3)20(23-4)19-16-8-6-5-7-14(16)9-10-17(15)19/h5-10,13H,11-12H2,1-4H3 |
| Isómeros SMILES | CN(C)CCC1=CC(=C(C2=C1C=CC3=CC=CC=C32)OC)OC |
| CAS alternativo | 5531-98-6 |
| PubChem CID | 96918 |
| Número NSC | 93678 |
| Términos de entrada MeSH | atherospermine;atherospermine hydrochloride;atherosperminine |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Alkaloids and derivatives |
| Clase | 6,6a-secoaporphines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 6,6a-secoaporphines |
| Alternative Parents | Phenanthrenes and derivatives Naphthalenes Phenethylamines Anisoles Aralkylamines Alkyl aryl ethers Trialkylamines Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | 6,6a-secoaporphine - Phenanthrene - Naphthalene - Phenethylamine - Anisole - Alkyl aryl ether - Aralkylamine - Benzenoid - Tertiary amine - Tertiary aliphatic amine - Ether - Organic nitrogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Organic oxygen compound - Amine - Aromatic homopolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as 6,6a-secoaporphines. These are alkaloids with a structure that contains an aminoethylphenanthrene moiety. |
| External Descriptors | Not available |
| Peso molecular | 309.400 g/mol |
|---|---|
| XLogP3 | 4.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 309.173 Da |
| Monoisotopic Mass | 309.173 Da |
| Topological Polar Surface Area | 21.700 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 373.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |