Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Description
Chemical structure: amino acid derivativesUsed in cell culture for the selection of HGPRT revertants.
| Sonrisas canónicas | C(C(C(=O)O)N)OC(=O)C=[N+]=[N-] |
|---|---|
| IUPAC Name | (2S)-2-amino-3-(2-diazoacetyl)oxypropanoic acid |
| InChIKey | MZZGOOYMKKIOOX-VKHMYHEASA-N |
| INCHI | 1S/C5H7N3O4/c6-3(5(10)11)2-12-4(9)1-8-7/h1,3H,2,6H2,(H,10,11)/t3-/m0/s1 |
| Isómeros SMILES | C([C@@H](C(=O)O)N)OC(=O)C=[N+]=[N-] |
| Número ONU | 3462 |
| Grupo de embalaje | I |
| Peso molecular | 173.13 |
| Reaxy-Rn | 1726603 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1726603&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives - Alpha amino acids |
| Direct Parent | L-alpha-amino acids |
| Alternative Parents | Alpha-diazo esters Dicarboxylic acids and derivatives Diazo compounds Carboxylic acid esters Amino acids Carboxylic acids Organopnictogen compounds Organic zwitterions Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | L-alpha-amino acid - Alpha-diazo ester - Dicarboxylic acid or derivatives - Carboxylic acid ester - Amino acid - Diazo compound - Carboxylic acid - Hydrocarbon derivative - Organic zwitterion - Organic nitrogen compound - Primary amine - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Organopnictogen compound - Organic oxide - Carbonyl group - Amine - Organic oxygen compound - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as l-alpha-amino acids. These are alpha amino acids which have the L-configuration of the alpha-carbon atom. |
| External Descriptors | carboxylic ester - non-proteinogenic L-alpha-amino acid - L-serine derivative - diazo compound |
| Sensibilidad | moisture sensitive |
|---|---|
| Peso molecular | 173.130 g/mol |
| XLogP3 | -3.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Exact Mass | 173.044 Da |
| Monoisotopic Mass | 173.044 Da |
| Topological Polar Surface Area | 91.600 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 233.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 1 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |