Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Azido-PEG9-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG9-alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups.
| Sonrisas canónicas | C(COCCOCCOCCOCCOCCOCCOCCOCCO)N=[N+]=[N-] |
|---|---|
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | XMVVXXBINVVEME-UHFFFAOYSA-N |
| INCHI | 1S/C18H37N3O9/c19-21-20-1-3-23-5-7-25-9-11-27-13-15-29-17-18-30-16-14-28-12-10-26-8-6-24-4-2-22/h22H,1-18H2 |
| Isómeros SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCO)N=[N+]=[N-] |
| PubChem CID | 102514759 |
| Peso molecular | 439.50 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Solubilidad | Solubility in Water, DMSO, DCM, DMF |
|---|---|
| Sensibilidad | Moisture sensitive |
| Peso molecular | 439.500 g/mol |
| XLogP3 | -0.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 11 |
| Rotatable Bond Count | 26 |
| Exact Mass | 439.253 Da |
| Monoisotopic Mass | 439.253 Da |
| Topological Polar Surface Area | 108.000 Ų |
| Heavy Atom Count | 30 |
| Formal Charge | 0 |
| Complexity | 375.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |