Determine the necessary mass, volume, or concentration for preparing a solution.
≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Barium dihydrogenphosphate is a stabilizer that is used as an organic solvent in the reaction system. It is also used to prevent impurities from forming and to maintain the pH of the reaction system. Barium dihydrogenphosphate has been shown to be soluble in water, alcohols, ethers, chloroform, benzene, or acetone. The solubility data for this compound are given in parts per million by weight. This compound also has three functional groups: hydroxyl group (OH), cavity (C), and nitrate (NO3). Impurities can be treated by adding triazine and silicon. Barium dihydrogenphosphate decomposes into barium oxide (BaO) and hydrogen phosphide gas (H2P).
| Sonrisas canónicas | OP(=O)(O)[O-].OP(=O)(O)[O-].[Ba+2] |
|---|---|
| Isómeros SMILES | OP(=O)(O)[O-].OP(=O)(O)[O-].[Ba+2] |
| Peso molecular | 331.30 |
| Reaxy-Rn | 16477716 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=16477716&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Peso molecular | 331.300 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 0 |
| Exact Mass | 331.843 Da |
| Monoisotopic Mass | 331.843 Da |
| Topological Polar Surface Area | 161.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 49.800 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |