Determine the necessary mass, volume, or concentration for preparing a solution.
≥99.9% metals basis, powder,≥200mesh for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Description
Ba2P2O7is a promising phosphor host material, showing different emission properties upon doping with rare earth and other elements. Bi doped Ba2P2O7crystals exhibit broadband NIR photoluminescence.
| Sonrisas canónicas | [O-]P(=O)([O-])OP(=O)([O-])[O-].[Ba+2].[Ba+2] |
|---|---|
| IUPAC Name | barium(2+);phosphonato phosphate |
| InChIKey | RCUAPGYXYWSYKO-UHFFFAOYSA-J |
| INCHI | 1S/2Ba.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q2*+2;/p-4 |
| Isómeros SMILES | [O-]P(=O)([O-])OP(=O)([O-])[O-].[Ba+2].[Ba+2] |
| Número ONU | 1564 |
| Peso molecular | 448.6 |
| Reaxy-Rn | 13386937 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=13386937&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Inorganic compounds |
|---|---|
| Superclass | Mixed metal/non-metal compounds |
| Clase | Alkaline earth metal oxoanionic compounds |
| Subclass | Alkaline earth metal pyrophosphates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkaline earth metal pyrophosphates |
| Alternative Parents | Inorganic salts Inorganic oxides |
| Molecular Framework | Not available |
| Substituents | Alkaline earth metal pyrophosphate - Inorganic oxide - Inorganic salt |
| Descripción | This compound belongs to the class of inorganic compounds known as alkaline earth metal pyrophosphates. These are inorganic compounds in which the largest oxoanion is pyrophosphate, and in which the heaviest atom not in an oxoanion is an alkaline earth metal. |
| External Descriptors | Not available |
| Punto de inflamación (°F) | Not applicable |
|---|---|
| Punto de inflamación (°C) | Not applicable |
| Peso molecular | 448.600 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 0 |
| Exact Mass | 449.722 Da |
| Monoisotopic Mass | 449.722 Da |
| Topological Polar Surface Area | 136.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 124.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |