Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | [B-](F)(F)(F)F.C1=CC=C(C=C1)[N+]#N |
|---|---|
| IUPAC Name | benzenediazonium;tetrafluoroborate |
| InChIKey | JNCLVGMBRSKDED-UHFFFAOYSA-N |
| INCHI | 1S/C6H5N2.BF4/c7-8-6-4-2-1-3-5-6;2-1(3,4)5/h1-5H;/q+1;-1 |
| Isómeros SMILES | [B-](F)(F)(F)F.C1=CC=C(C=C1)[N+]#N |
| CAS alternativo | 369-57-3,1333925-04-4 |
| PubChem CID | 5284485 |
| Términos de entrada MeSH | benzenediazonium;benzenediazonium chloride;benzenediazonium hexafluorophosphate (-1);benzenediazonium ion;benzenediazonium nitrate;benzenediazonium sulfate (1:1);benzenediazonium sulfate (2:1);benzenediazonium tetrafluoroborate;benzenediazonium tetrafluor |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | Organic diazonium salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diazonium tetrahaloborates |
| Alternative Parents | Benzene and substituted derivatives Organic metalloid salts Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Diazonium tetrahaloborate - Benzenoid - Monocyclic benzene moiety - Organic metalloid salt - Organopnictogen compound - Hydrocarbon derivative - Organic salt - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as diazonium tetrahaloborates. These are organic compounds containing a tetrahaloborate ion and a diazonium ion. |
| External Descriptors | Not available |
| Peso molecular | 191.920 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 0 |
| Exact Mass | 192.048 Da |
| Monoisotopic Mass | 192.048 Da |
| Topological Polar Surface Area | 28.200 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 124.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |