Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504762576 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504762576 |
| Sonrisas canónicas | COC(=O)C1=CC=C(C=C1)SSC2=CC=C(C=C2)C(=O)OC |
| IUPAC Name | methyl 4-[(4-methoxycarbonylphenyl)disulfanyl]benzoate |
| InChIKey | VGCZYLQMVYJBNY-UHFFFAOYSA-N |
| INCHI | 1S/C16H14O4S2/c1-19-15(17)11-3-7-13(8-4-11)21-22-14-9-5-12(6-10-14)16(18)20-2/h3-10H,1-2H3 |
| Isómeros SMILES | COC(=O)C1=CC=C(C=C1)SSC2=CC=C(C=C2)C(=O)OC |
| Peso molecular | 334.4 |
| Reaxy-Rn | 2223814 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2223814&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Sulfanylbenzoic acids and derivatives |
| Direct Parent | P-sulfanylbenzoic acids and derivatives |
| Alternative Parents | Benzoic acid esters Benzoyl derivatives Dicarboxylic acids and derivatives Methyl esters Organic disulfides Sulfenyl compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | P-sulfanylbenzoic acid or derivatives - Benzoate ester - Benzoyl - Dicarboxylic acid or derivatives - Methyl ester - Organic disulfide - Carboxylic acid ester - Sulfenyl compound - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as p-sulfanylbenzoic acids and derivatives. These are benzoic acids (or derivatives) which bear a sulfanyl group (R-SH) attached to the benzene ring at positions 1 and 4, respectively. |
| External Descriptors | Not available |
| Solubilidad | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
|---|---|
| Punto de fusión (°C) | 116-119°C |
| Peso molecular | 334.400 g/mol |
| XLogP3 | 4.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 7 |
| Exact Mass | 334.033 Da |
| Monoisotopic Mass | 334.033 Da |
| Topological Polar Surface Area | 103.000 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 336.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |