Determine the necessary mass, volume, or concentration for preparing a solution.
Bis(4-methoxyphenyl)phosphinic acid can be used to treat the chemical surface of porphyrin-sensitised titania films after dye adsorption to enhance the efficiency of dye-sensitized solar cells.
| Pubchem Sid | 488190795 |
|---|---|
| Sonrisas canónicas | COC1=CC=C(C=C1)P(=O)(C2=CC=C(C=C2)OC)O |
| IUPAC Name | bis(4-methoxyphenyl)phosphinic acid |
| InChIKey | BFPBWJGVRNQWEK-UHFFFAOYSA-N |
| INCHI | 1S/C14H15O4P/c1-17-11-3-7-13(8-4-11)19(15,16)14-9-5-12(18-2)6-10-14/h3-10H,1-2H3,(H,15,16) |
| Isómeros SMILES | COC1=CC=C(C=C1)P(=O)(C2=CC=C(C=C2)OC)O |
| Peso molecular | 278.24 |
| Reaxy-Rn | 2942972 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2942972&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Phenol ethers |
| Subclass | Anisoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anisoles |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Alkyl aryl ethers Organopnictogen compounds Organophosphorus compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Methoxybenzene - Anisole - Alkyl aryl ether - Monocyclic benzene moiety - Ether - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organophosphorus compound - Organooxygen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as anisoles. These are organic compounds containing a methoxybenzene or a derivative thereof. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
| Certificate of Analysis | Mar 09, 2026 | B356860 | |
| Certificate of Analysis | Mar 09, 2026 | B356860 | |
| Certificate of Analysis | Mar 09, 2026 | B356860 | |
| Certificate of Analysis | Mar 09, 2026 | B356860 | |
| Certificate of Analysis | Mar 09, 2026 | B356860 | |
| Certificate of Analysis | Mar 09, 2026 | B356860 |
| Punto de fusión (°C) | 185-187° C (lit.) |
|---|---|
| Peso molecular | 278.240 g/mol |
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 278.071 Da |
| Monoisotopic Mass | 278.071 Da |
| Topological Polar Surface Area | 55.800 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 289.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |