Information
Boc-NH-PEG1-CH2COOH is a PEG-based PROTAC linker that is applicable to the synthesis of PROTACs.
Application
This is a crosslinker with a t-Boc protected amine on one end and a carboxyl group on the other end. The compound contains a single PEG unit to help improve solubility
t-Boc-N-amido-PEG1-CH2CO2H is a heterobifunctional, PEGylated crosslinker featuring a Boc-protected amine at one end and a carboxyl group at the other. The hydrophillic PEG linker facilitates solubility in biological applications. t-Boc-N-amido-PEG1-CH2CO2H can be used for bioconjugation or as a building block for synthesis of small molecules, conjugates of small molecules and/or biomolecules, or other tool compounds for chemical biology and medicinal chemistry that require ligation.
| Pubchem Sid | 504767752 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504767752 |
| Sonrisas canónicas | CC(C)(C)OC(=O)NCCOCC(=O)O |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]acetic acid |
| InChIKey | UPBQMAHYLWJGDW-UHFFFAOYSA-N |
| INCHI | 1S/C9H17NO5/c1-9(2,3)15-8(13)10-4-5-14-6-7(11)12/h4-6H2,1-3H3,(H,10,13)(H,11,12) |
| Isómeros SMILES | CC(C)(C)OC(=O)NCCOCC(=O)O |
| Peso molecular | 219.23 |
| Reaxy-Rn | 5429237 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5429237&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Carbamic acids and derivatives |
| Direct Parent | Carbamate esters |
| Alternative Parents | Monocarboxylic acids and derivatives Dialkyl ethers Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Carbamic acid ester - Monocarboxylic acid or derivatives - Ether - Dialkyl ether - Carboxylic acid - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as carbamate esters. These are compounds containing an ester of carbamic acid with the general structure R2NC(=O)OR' (R' not H). They are esters of carbamic acids. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
 B23071176 | Certificate of Analysis | Nov 07, 2025 | B412741 |
| B23071183 | Certificate of Analysis | Nov 07, 2025 | B412741 |
| B2307552 | Certificate of Analysis | Nov 07, 2025 | B412741 |
| B2307791 | Certificate of Analysis | Nov 07, 2025 | B412741 |
| C2513369 | Certificate of Analysis | Oct 26, 2022 | B412741 |
| Solubilidad | Solubility (25°C) In vitro |
|---|---|
| Sensibilidad | Heat sensitive |
| Peso molecular | 219.230 g/mol |
| XLogP3 | 0.400 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 7 |
| Exact Mass | 219.111 Da |
| Monoisotopic Mass | 219.111 Da |
| Topological Polar Surface Area | 84.900 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 221.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
