Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Chloroacetamido-PEG4-t-Butyl Ester is a PEG derivative containing a chloroacetamide and a t-butyl ester. The chlorine is a good leaving group and can undergo substitution reactions. The t-butyl group is an acid labile protecting group. Upon removal, the carboxylic acid can be further reacted. The hydrophilic PEG chain increases the water solubilty of compounds in aqueous media.
| Sonrisas canónicas | CC(C)(C)OC(=O)CCOCCOCCOCCOCCNC(=O)CCl |
|---|---|
| IUPAC Name | tert-butyl 3-[2-[2-[2-[2-[(2-chloroacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | VCADUZGDEHVWCF-UHFFFAOYSA-N |
| INCHI | 1S/C17H32ClNO7/c1-17(2,3)26-16(21)4-6-22-8-10-24-12-13-25-11-9-23-7-5-19-15(20)14-18/h4-14H2,1-3H3,(H,19,20) |
| Isómeros SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCNC(=O)CCl |
| PubChem CID | 60146192 |
| Peso molecular | 397.9 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Peso molecular | 397.900 g/mol |
|---|---|
| XLogP3 | 0.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 18 |
| Exact Mass | 397.187 Da |
| Monoisotopic Mass | 397.187 Da |
| Topological Polar Surface Area | 92.300 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 375.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |