Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C[Si](C)(C)C[Si](C)(C)CCl |
|---|---|
| IUPAC Name | chloromethyl-dimethyl-(trimethylsilylmethyl)silane |
| InChIKey | WBZTYASEAQTKBK-UHFFFAOYSA-N |
| INCHI | 1S/C7H19ClSi2/c1-9(2,3)7-10(4,5)6-8/h6-7H2,1-5H3 |
| Isómeros SMILES | C[Si](C)(C)C[Si](C)(C)CCl |
| PubChem CID | 87574 |
| Peso molecular | 194.85 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic salts |
| Clase | Organic metal salts |
| Subclass | Organic metalloid salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organic metalloid salts |
| Alternative Parents | Organochlorides Hydrocarbon derivatives Alkylsilanes Alkyl chlorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Organic metalloid salt - Hydrocarbon derivative - Organosilicon compound - Alkylsilane - Organochloride - Organohalogen compound - Alkyl halide - Alkyl chloride - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as organic metalloid salts. These are organic salt compounds containing a metalloid atom in its ionic form. |
| External Descriptors | Not available |
| Peso molecular | 194.850 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 3 |
| Exact Mass | 194.071 Da |
| Monoisotopic Mass | 194.071 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 105.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |