Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=C2C(=CC(=C1Cl)S(=O)(=O)N)S(=O)(=O)[N-]C=N2.[Na+] |
|---|---|
| IUPAC Name | sodium;6-chloro-1,1-dioxo-1lambda6,2,4-benzothiadiazin-2-ide-7-sulfonamide |
| InChIKey | CPIWHAFLBZQYLQ-UHFFFAOYSA-N |
| INCHI | 1S/C7H5ClN3O4S2.Na/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5;/h1-3H,(H2-,9,10,11,12,13);/q-1;+1 |
| Isómeros SMILES | C1=C2C(=CC(=C1Cl)S(=O)(=O)N)S(=O)(=O)[N-]C=N2.[Na+] |
| PubChem CID | 23675744 |
| Peso molecular | 317.7 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Thiadiazines |
| Subclass | Benzothiadiazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1,2,4-benzothiadiazine-1,1-dioxides |
| Alternative Parents | Organosulfonamides Benzenoids Aryl chlorides Aminosulfonyl compounds Propargyl-type 1,3-dipolar organic compounds Organic metal halides Carbene-type 1,3-dipolar compounds Azacyclic compounds Organonitrogen compounds Organochlorides Organic zwitterions Organic sodium salts Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 1,2,4-benzothiadiazine-1,1-dioxide - Aryl chloride - Aryl halide - Organosulfonic acid amide - Benzenoid - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl - Aminosulfonyl compound - Organic metal halide - Azacycle - Organic alkali metal salt - Propargyl-type 1,3-dipolar organic compound - Carbene-type 1,3-dipolar compound - Organic 1,3-dipolar compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organosulfur compound - Organic zwitterion - Organic sodium salt - Organohalogen compound - Organochloride - Organonitrogen compound - Organic salt - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as 1,2,4-benzothiadiazine-1,1-dioxides. These are aromatic heterocyclic compounds containing a 1,2,4-benzothiadiazine ring system with two S=O bonds at the 1-position. |
| External Descriptors | Not available |
| Peso molecular | 317.700 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 1 |
| Exact Mass | 316.931 Da |
| Monoisotopic Mass | 316.931 Da |
| Topological Polar Surface Area | 124.000 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 538.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |