≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Product application:
cis-Decahydro-1-naphthol (DHN) was used in the solid-phase microextraction (SPME) and membrane-assisted solvent extraction (MASE) method for the detection of 2-methylisoborneol and geosmin in aqueous samples.
| Pubchem Sid | 504770800 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504770800 |
| Sonrisas canónicas | C1CCC2C(C1)CCCC2O |
| IUPAC Name | (1S,4aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol |
| InChIKey | NDZOISQLWLWLEW-SMILAEQMSA-N |
| INCHI | 1S/C10H18O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h8-11H,1-7H2/t8-,9?,10-/m0/s1 |
| Isómeros SMILES | C1CCC2[C@@H](C1)CCC[C@@H]2O |
| WGK Alemania | 3 |
| CAS alternativo | 207127-50-2 |
| Peso molecular | 154.25 |
| Reaxy-Rn | 2038141 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2038141&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cyclic alcohols and derivatives |
| Alternative Parents | Secondary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Cyclic alcohol - Secondary alcohol - Hydrocarbon derivative - Aliphatic homopolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as cyclic alcohols and derivatives. These are organic compounds containing an aliphatic ring substituted with at least one hydroxyl group. |
| External Descriptors | Not available |
| Punto de ebullición (°C) | 238°C |
|---|---|
| Punto de fusión (°C) | 89-92°C |
| Peso molecular | 154.250 g/mol |
| XLogP3 | 2.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 154.136 Da |
| Monoisotopic Mass | 154.136 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 133.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
K2310103