Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
γ-secretase inhibitor; 5-HT3 Receptor Agonist;
| ALogP | 3.53 |
|---|---|
| hba_count | 1 |
| Recuento HBD | 1 |
| Enlace rotable | 3 |
| Pubchem Sid | 504760143 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504760143 |
| Sonrisas canónicas | C1=CC=C(C=C1)CNC(=O)C2=CC3=CC=CC=C3C=C2 |
| IUPAC Name | N-benzylnaphthalene-2-carboxamide |
| InChIKey | DKPOPWSPIGABJL-UHFFFAOYSA-N |
| INCHI | 1S/C18H15NO/c20-18(19-13-14-6-2-1-3-7-14)17-11-10-15-8-4-5-9-16(15)12-17/h1-12H,13H2,(H,19,20) |
| Isómeros SMILES | C1=CC=C(C=C1)CNC(=O)C2=CC3=CC=CC=C3C=C2 |
| Peso molecular | 261.32 |
| Reaxy-Rn | 3318554 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3318554&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Naphthalenes |
| Subclass | Naphthalenecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthalenecarboxamides |
| Alternative Parents | Benzene and substituted derivatives Secondary carboxylic acid amides Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | 2-naphthalenecarboxamide - Monocyclic benzene moiety - Secondary carboxylic acid amide - Carboxamide group - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic homopolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as naphthalenecarboxamides. These are compounds containing a naphthalene moiety, which bears a carboxylic acid amide group at one or more positions. Naphthalene is a bicyclic compound that is made up of two fused benzene rings. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
| Certificate of Analysis | Sep 08, 2025 | C416689 | |
| Certificate of Analysis | Sep 08, 2025 | C416689 | |
| Certificate of Analysis | Sep 08, 2025 | C416689 | |
| Certificate of Analysis | Sep 08, 2025 | C416689 | |
| Certificate of Analysis | Sep 08, 2025 | C416689 |
| DMSO (mM) Solubilidad máxima | 10 |
|---|---|
| Peso molecular | 261.300 g/mol |
| XLogP3 | 4.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 261.115 Da |
| Monoisotopic Mass | 261.115 Da |
| Topological Polar Surface Area | 29.100 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 321.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |