Determine the necessary mass, volume, or concentration for preparing a solution.
≥90%(mixture of isomers) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Store at -20°C,Argon charged Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 528773145 |
|---|---|
| Sonrisas canónicas | CCC(=NOCC=CCl)C1=C(CC(CC1=O)CC(C)SCC)O |
| IUPAC Name | 2-[(E)-N-[(E)-3-chloroprop-2-enoxy]-C-ethylcarbonimidoyl]-5-(2-ethylsulfanylpropyl)-3-hydroxycyclohex-2-en-1-one |
| InChIKey | SILSDTWXNBZOGF-KUZBFYBWSA-N |
| INCHI | 1S/C17H26ClNO3S/c1-4-14(19-22-8-6-7-18)17-15(20)10-13(11-16(17)21)9-12(3)23-5-2/h6-7,12-13,20H,4-5,8-11H2,1-3H3/b7-6+,19-14+ |
| Isómeros SMILES | CC/C(=N\OC/C=C/Cl)/C1=C(CC(CC1=O)CC(C)SCC)O |
| Peso molecular | 359.91 |
| Reaxy-Rn | 14341207 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14341207&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Cyclic ketones |
| Direct Parent | Cyclohexenones |
| Alternative Parents | Vinylogous acids Oxime ethers Vinyl chlorides Sulfenyl compounds Enols Dialkylthioethers Chloroalkenes Organopnictogen compounds Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cyclohexenone - Vinylogous acid - Oxime ether - Enol - Thioether - Vinyl chloride - Chloroalkene - Haloalkene - Dialkylthioether - Sulfenyl compound - Vinyl halide - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organosulfur compound - Organonitrogen compound - Organochloride - Organohalogen compound - Aliphatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as cyclohexenones. These are compounds containing a cylohexenone moiety, which is a six-membered aliphatic ring that carries a ketone and has one endocyclic double bond. |
| External Descriptors | Cyclohexene oxime herbicides |
| Sensibilidad | light & air sensitive |
|---|---|
| Peso molecular | 359.900 g/mol |
| XLogP3 | 3.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 9 |
| Exact Mass | 359.132 Da |
| Monoisotopic Mass | 359.132 Da |
| Topological Polar Surface Area | 84.200 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 488.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 2 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 2 |
| Covalently-Bonded Unit Count | 1 |
| 1. Fengping Liu, Aiming Zhong, Qin Xu, Hongen Cao, Xiaoya Hu. (2016) Inhibition of 2,4-Dichlorophenoxyacetic Acid to Catalase Immobilized on Hierarchical Porous Calcium Phosphate: Kinetic Aspect and Electrochemical Biosensor Construction. Journal of Physical Chemistry C, [PMID:] [10.1021/acs.jpcc.5b12559] |