Determine the necessary mass, volume, or concentration for preparing a solution.
≥99.998% metals basis for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships FedEx DG Service Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | O.[O-]S(=O)(=O)[O-].[Co+2] |
|---|---|
| IUPAC Name | cobalt(2+);sulfate;hydrate |
| InChIKey | BGORGFZEVHFAQU-UHFFFAOYSA-L |
| INCHI | 1S/Co.H2O4S.H2O/c;1-5(2,3)4;/h;(H2,1,2,3,4);1H2/q+2;;/p-2 |
| Isómeros SMILES | O.[O-]S(=O)(=O)[O-].[Co+2] |
| WGK Alemania | 3 |
| CAS alternativo | 10124-43-3 |
| Número ONU | 3077 |
| Peso molecular | 155 |
| Reaxy-Rn | 16375790 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=16375790&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Inorganic compounds |
|---|---|
| Superclass | Mixed metal/non-metal compounds |
| Clase | Transition metal oxoanionic compounds |
| Subclass | Transition metal sulfates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Transition metal sulfates |
| Alternative Parents | Inorganic oxides Inorganic cobalt salts |
| Molecular Framework | Not available |
| Substituents | Transition metal sulfate - Inorganic cobalt salt - Inorganic oxide - Inorganic salt |
| Descripción | This compound belongs to the class of inorganic compounds known as transition metal sulfates. These are inorganic compounds in which the largest oxoanion is sulfate, and in which the heaviest atom not in an oxoanion is a transition metal. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
| Certificate of Analysis | Mar 06, 2024 | C113635 |
| Peso molecular | 173.010 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Exact Mass | 172.895 Da |
| Monoisotopic Mass | 172.895 Da |
| Topological Polar Surface Area | 89.600 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 62.200 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
| 1. Mengying Cai, Zhixiong Huang, Yiling Huang, Jian Zou, Shaojun Shi, Fei Geng. (2020) Construction of a surface heterosphere for a Li-rich manganese-based cathode with improved Li storage properties. CERAMICS INTERNATIONAL, [PMID:] [10.1016/j.ceramint.2020.12.089] |
| 2. Runkun Zhang, Yanhui Zhong, Yufei Hu, Yi Chen, Ling Xia, Gongke Li. (2024) Liquid-Phase Cyclic Chemiluminescence for the Identification of Cobalt Speciation. ANALYTICAL CHEMISTRY, [PMID:38359085] [10.1021/acs.analchem.3c05864] |