Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature,Desiccated Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | [B-](F)(F)(F)F.[B-](F)(F)(F)F.[Co+2] |
|---|---|
| IUPAC Name | cobalt(2+);ditetrafluoroborate |
| InChIKey | SSIMDEJNGHHZCA-UHFFFAOYSA-N |
| INCHI | 1S/2BF4.Co/c2*2-1(3,4)5;/q2*-1;+2 |
| Isómeros SMILES | [B-](F)(F)(F)F.[B-](F)(F)(F)F.[Co+2] |
| CAS alternativo | 26490-63-1 |
| PubChem CID | 62811 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Inorganic compounds |
|---|---|
| Superclass | Mixed metal/non-metal compounds |
| Clase | Metalloid salts |
| Subclass | Metalloid fluorides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Metalloid fluorides |
| Alternative Parents | Inorganic cobalt salts |
| Molecular Framework | Not available |
| Substituents | Metalloid fluoride - Inorganic cobalt salt - Inorganic salt |
| Descripción | This compound belongs to the class of inorganic compounds known as metalloid fluorides. These are inorganic compounds in which the largest halogen atom is fluorine, and the heaviest metal atom is a metalloid. |
| External Descriptors | Not available |
| Peso molecular | 232.550 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 0 |
| Exact Mass | 232.939 Da |
| Monoisotopic Mass | 232.939 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 19.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |