Determine the necessary mass, volume, or concentration for preparing a solution.
D-Maltotriose Peracetate, a derivative of maltotriose, has garnered attention in scientific research for its utility in various applications, particularly in carbohydrate chemistry and enzymology. As a peracetate derivative, it serves as a versatile substrate for enzymatic studies and kinetic analyses of enzymes involved in carbohydrate metabolism. One notable research application involves its use as a substrate for glycoside hydrolases, glycosyltransferases, and other carbohydrate-active enzymes. By enzymatically hydrolyzing D-Maltotriose Peracetate, researchers can explain the catalytic mechanisms, substrate specificity, and kinetics of these enzymes, contributing to a deeper understanding of carbohydrate processing pathways in biological systems. Furthermore, D-Maltotriose Peracetate and its derivatives have been employed in the synthesis of complex carbohydrate structures and glycotechnology research. These compounds serve as valuable tools for the preparation of glycoconjugates, glycomimetics, and carbohydrate-based materials, facilitating investigations into carbohydrate-protein interactions, cell surface recognition, and carbohydrate-mediated biological processes. Overall, D-Maltotriose Peracetate plays a crucial role in advancing research endeavors aimed at unraveling the intricacies of carbohydrate biochemistry and exploring their diverse applications in various scientific fields.
| Sonrisas canónicas | CC(=O)OCC1C(C(C(C(O1)OC2C(OC(C(C2OC(=O)C)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)OC3C(C(C(C(O3)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
|---|---|
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-[(2R,3R,4S,5R)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxy-3-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| InChIKey | NNLVGZFZQQXQNW-BDYSLRNRSA-N |
| INCHI | 1S/C40H54O27/c1-15(41)52-12-26-29(55-18(4)44)32(56-19(5)45)36(60-23(9)49)39(64-26)67-31-28(14-54-17(3)43)65-40(37(61-24(10)50)34(31)58-21(7)47)66-30-27(13-53-16(2)42)63-38(62-25(11)51)35(59-22(8)48)33(30)57-20(6)46/h26-40H,12-14H2,1-11H3/t26-,27-,28-,29-,30-,31-,32+,33+,34+,35-,36-,37-,38?,39-,40-/m1/s1 |
| Isómeros SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@H](OC([C@@H]([C@H]2OC(=O)C)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| Peso molecular | 966.84 |
| Reaxy-Rn | 50474858 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=50474858&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Oligosaccharides |
| Alternative Parents | O-glycosyl compounds Oxanes Carboxylic acid esters Oxacyclic compounds Acetals Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Oligosaccharide - O-glycosyl compound - Glycosyl compound - Oxane - Carboxylic acid ester - Oxacycle - Organoheterocyclic compound - Carboxylic acid derivative - Acetal - Organic oxide - Hydrocarbon derivative - Carbonyl group - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
| Certificate of Analysis | Mar 20, 2025 | D350756 | |
| Certificate of Analysis | Mar 20, 2025 | D350756 | |
| Certificate of Analysis | Mar 20, 2025 | D350756 | |
| Certificate of Analysis | Mar 20, 2025 | D350756 |
| Peso molecular | 966.800 g/mol |
|---|---|
| XLogP3 | -1.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 27 |
| Rotatable Bond Count | 29 |
| Exact Mass | 966.285 Da |
| Monoisotopic Mass | 966.285 Da |
| Topological Polar Surface Area | 335.000 Ų |
| Heavy Atom Count | 67 |
| Formal Charge | 0 |
| Complexity | 1850.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 14 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |