Determine the necessary mass, volume, or concentration for preparing a solution.
D-Saccharic acid potassium salt is a compound formed from oxidizing sugars, which can be used to test for the presence of hepatic enzyme induction. Studies indicate that D-glucuronolactone dehydrogenase oxidizes D-Saccharic acid potassium salt into D-glucaro-l,4;6,3-dilactone. Alternate studies suggest that D-Saccharic acid potassium salt forms a complex with Cu(II) and H|2|O|2|to decolorize azo, acridine, triphenyl methane, anthraquinone and thiazine-based dyes.
| Sonrisas canónicas | C(C(C(C(=O)[O-])O)O)(C(C(=O)O)O)O.[K+] |
|---|---|
| IUPAC Name | potassium;(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxy-6-oxohexanoate |
| InChIKey | UBYZGUWQNIEQMH-IAMDKXPVSA-M |
| INCHI | 1S/C6H10O8.K/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h1-4,7-10H,(H,11,12)(H,13,14);/q;+1/p-1/t1-,2-,3-,4+;/m1./s1 |
| Isómeros SMILES | [C@@H]([C@H]([C@H](C(=O)[O-])O)O)([C@@H](C(=O)O)O)O.[K+] |
| RTECS | LZ4291900 |
| Peso molecular | 248.23 |
| Reaxy-Rn | 18245316 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=18245316&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Sugar acids and derivatives |
| Direct Parent | Glucuronic acid derivatives |
| Alternative Parents | Pentoses Medium-chain hydroxy acids and derivatives Medium-chain fatty acids Beta hydroxy acids and derivatives Hydroxy fatty acids Alpha hydroxy acids and derivatives Dicarboxylic acids and derivatives Secondary alcohols Carboxylic acid salts Polyols Carboxylic acids Organic potassium salts Organic oxides Carbonyl compounds Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Glucuronic acid or derivatives - Pentose monosaccharide - Medium-chain hydroxy acid - Medium-chain fatty acid - Beta-hydroxy acid - Hydroxy fatty acid - Alpha-hydroxy acid - Dicarboxylic acid or derivatives - Fatty acyl - Fatty acid - Hydroxy acid - Monosaccharide - Carboxylic acid salt - Secondary alcohol - Organic alkali metal salt - Carboxylic acid - Carboxylic acid derivative - Polyol - Organic salt - Organic potassium salt - Alcohol - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organic cation - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as glucuronic acid derivatives. These are compounds containing a glucuronic acid moiety (or a derivative), which consists of a glucose moiety with the C6 carbon oxidized to a carboxylic acid. |
| External Descriptors | Not available |
| Punto de fusión (°C) | 188° C |
|---|---|
| Peso molecular | 248.230 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 5 |
| Exact Mass | 247.993 Da |
| Monoisotopic Mass | 247.993 Da |
| Topological Polar Surface Area | 158.000 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 231.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |