Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1=C2C=CC3=C(C2=CC=C1)C(=O)C(=O)C(=C3O)C |
|---|---|
| IUPAC Name | 1-hydroxy-2,8-dimethylphenanthrene-3,4-dione |
| InChIKey | XUULFFYQZPYLEM-UHFFFAOYSA-N |
| INCHI | 1S/C16H12O3/c1-8-4-3-5-11-10(8)6-7-12-13(11)16(19)15(18)9(2)14(12)17/h3-7,17H,1-2H3 |
| Isómeros SMILES | CC1=C2C=CC3=C(C2=CC=C1)C(=O)C(=O)C(=C3O)C |
| PubChem CID | 5320114 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Phenanthrenes and derivatives |
| Subclass | Phenanthrols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenanthrols |
| Alternative Parents | Hydrophenanthrenes Naphthoquinones Naphthols and derivatives Quinones Aryl ketones Vinylogous acids Enols Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Phenanthrol - Hydrophenanthrene - Naphthoquinone - 1-naphthol - Naphthalene - Aryl ketone - Quinone - Vinylogous acid - Ketone - Cyclic ketone - Enol - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Carbonyl group - Organooxygen compound - Aromatic homopolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenanthrols. These are compounds containing a phenanthrene (or its hydrogenated derivative) to which a hydroxyl group is attached. |
| External Descriptors | Not available |
| Peso molecular | 252.260 g/mol |
|---|---|
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 252.079 Da |
| Monoisotopic Mass | 252.079 Da |
| Topological Polar Surface Area | 54.400 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 463.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |