Ischemin sodium salt

ID: ALA5316212

Max Phase: Preclinical

Molecular Formula: C15H16N3NaO4S

Molecular Weight: 335.39

This compound is not in our inventory system

Associated Items:

Nombres e identificadores

Canonical SMILES:  Cc1cc(/N=N/c2cc(S(=O)(=O)[O-])c(C)cc2C)c(N)cc1O.[Na+]

Standard InChI:  InChI=1S/C15H17N3O4S.Na/c1-8-4-10(3)15(23(20,21)22)7-12(8)17-18-13-5-9(2)14(19)6-11(13)16;/h4-7,19H,16H2,1-3H3,(H,20,21,22);/q;+1/p-1/b18-17+;

Standard InChI Key:  ZTDQQIATQGCZBV-ZAGWXBKKSA-M

Molfile:  

     RDKit          2D

 24 24  0  0  0  0  0  0  0  0999 V2000
    3.0752    3.3206    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
    1.3979    2.0088    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0311   -0.4662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7455   -0.0537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4600   -0.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6834   -0.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6034   -1.7037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1123    0.7713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1745    0.7713    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1745   -2.5287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8268    1.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3979   -1.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3979    2.8338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8890   -1.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5729    2.0088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2229    2.0088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1745   -0.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4600   -1.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8890   -0.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1745   -1.7037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6834    0.7713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3979   -0.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3979    1.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1123   -0.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 13  2  1  0
 15  2  2  0
 16  2  2  0
 23  2  1  0
  3  4  2  0
  6  3  1  0
  5  4  1  0
 17  5  2  0
 18  5  1  0
  6 21  2  0
  6 22  1  0
 14  7  1  0
  8 11  1  0
 23  8  2  0
 24  8  1  0
 17  9  1  0
 20 10  1  0
 22 12  1  0
 19 14  2  0
 20 14  1  0
 17 19  1  0
 18 20  2  0
 21 23  1  0
 22 24  2  0
M  CHG  2   1   1  13  -1
M  END

Objetivos asociados (no humanos)

Schistosoma mansoni (6170 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoDisponibilidad: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferencias

Mecanismos de acción

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferencias

Calculated Properties

Molecular Weight: 335.39Molecular Weight (Monoisotopic): 335.0940AlogP: 3.56#Rotatable Bonds: 3
Polar Surface Area: 125.34Molecular Species: ACIDHBA: 6HBD: 3
#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄
CX Acidic pKa: -4.07CX Basic pKa: 1.19CX LogP: 3.23CX LogD: 1.55
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.45Np Likeness Score: -0.30

Referencias

1. Gilda Padalino, Avril Coghlan, Giampaolo Pagliuca, Josephine F. Thomas, Matthew Berriman, Karl F. Hoffmann.  (2023)  Using ChEMBL to complement schistosome drug discovery,  [10.6019/CHEMBL5096127]

Shall we send you a message when we have discounts available?

Remind me later

Thank you! Please check your email inbox to confirm.

Oops! Notifications are disabled.