Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
PEG11 is a polymer consisting of 11 ethylene glycol subunits and two terminal hydroxyl groups. The hydroxyl groups can be reacted to further derivatize the compound. The hydrophilic PEG linkers increase the water solubility of the compound under aqueous environments. The water solubility properties of the PEG chain are enhanced with longer chains.
| Sonrisas canónicas | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCO)O |
|---|---|
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | DTPCFIHYWYONMD-UHFFFAOYSA-N |
| INCHI | 1S/C20H42O11/c21-1-3-23-5-7-25-9-11-27-13-15-29-17-19-31-20-18-30-16-14-28-12-10-26-8-6-24-4-2-22/h21-22H,1-20H2 |
| Isómeros SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCO)O |
| Peso molecular | 458.55 |
| Reaxy-Rn | 1891396 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1891396&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Dialkyl ethers |
| Direct Parent | Polyethylene glycols |
| Alternative Parents | Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Polyethylene glycol - Hydrocarbon derivative - Primary alcohol - Alcohol - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as polyethylene glycols. These are oligomers or polymers of ethylene oxide, with the general formula (C2H4O)n (with n>=3). |
| External Descriptors | poly(ethylene glycol) |
| Punto de ebullición (°C) | 280°C/7mmHg |
|---|---|
| Punto de fusión (°C) | 28°C |
| Peso molecular | 458.500 g/mol |
| XLogP3 | -2.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 11 |
| Rotatable Bond Count | 28 |
| Exact Mass | 458.273 Da |
| Monoisotopic Mass | 458.273 Da |
| Topological Polar Surface Area | 124.000 Ų |
| Heavy Atom Count | 31 |
| Formal Charge | 0 |
| Complexity | 283.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |