Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Di-β-D-xylopyranosylamine is a diglycosylamine generated from the transglycosylation of β-D-xylopyranosylamine.
| Sonrisas canónicas | C1C(C(C(C(O1)NC2C(C(C(CO2)O)O)O)O)O)O |
|---|---|
| IUPAC Name | (2R,3R,4S,5R)-2-[[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]amino]oxane-3,4,5-triol |
| InChIKey | WDQLRJPDYLYTMJ-IJNKSVJISA-N |
| INCHI | 1S/C10H19NO8/c12-3-1-18-9(7(16)5(3)14)11-10-8(17)6(15)4(13)2-19-10/h3-17H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-/m1/s1 |
| Isómeros SMILES | C1[C@H]([C@@H]([C@H]([C@@H](O1)N[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O)O)O)O |
| WGK Alemania | 3 |
| PubChem CID | 14100617 |
| Peso molecular | 281.26 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Glycosyl compounds |
| Direct Parent | Glycosylamines |
| Alternative Parents | N-linked disaccharides Oxanes Secondary alcohols Hemiaminals 1,2-diols Secondary amines Oxacyclic compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Disaccharide - N-glycosyl compound - N-linked disaccharide - Oxane - Secondary alcohol - 1,2-diol - Hemiaminal - Organoheterocyclic compound - Secondary amine - Polyol - Oxacycle - Organonitrogen compound - Hydrocarbon derivative - Organic nitrogen compound - Amine - Alcohol - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as glycosylamines. These are compounds consisting of an amine with a beta-N-glycosidic bond to a carbohydrate, thus forming a cyclic hemiaminal ether bond (alpha-amino ether). |
| External Descriptors | Not available |
| Peso molecular | 281.260 g/mol |
|---|---|
| XLogP3 | -4.300 |
| Hydrogen Bond Donor Count | 7 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 2 |
| Exact Mass | 281.111 Da |
| Monoisotopic Mass | 281.111 Da |
| Topological Polar Surface Area | 152.000 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 277.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 8 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |