| Sonrisas canónicas | C1=CC=C(C=C1)C(=[N+]=[N-])C2=CC=CC=C2 |
|---|---|
| IUPAC Name | [diazo(phenyl)methyl]benzene |
| InChIKey | ITLHXEGAYQFOHJ-UHFFFAOYSA-N |
| INCHI | 1S/C13H10N2/c14-15-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| Isómeros SMILES | C1=CC=C(C=C1)C(=[N+]=[N-])C2=CC=CC=C2 |
| PubChem CID | 61230 |
| Peso molecular | 194.23 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Diphenylmethanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diphenylmethanes |
| Alternative Parents | Diazo compounds Organopnictogen compounds Organonitrogen compounds Organic salts Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Diphenylmethane - Diazo compound - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organic salt - Organonitrogen compound - Organic cation - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as diphenylmethanes. These are compounds containing a diphenylmethane moiety, which consists of a methane wherein two hydrogen atoms are replaced by two phenyl groups. |
| External Descriptors | Not available |
| Peso molecular | 194.230 g/mol |
|---|---|
| XLogP3 | 3.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 194.084 Da |
| Monoisotopic Mass | 194.084 Da |
| Topological Polar Surface Area | 2.000 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 221.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![[Diazo(phenyl)methyl]benzene - ≥98% , CAS No.883-40-9](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)