Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature,Argon charged Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 329765501 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504766138 |
| Sonrisas canónicas | C1CC=CCCC=C1.Br[Pd]Br |
| IUPAC Name | (1Z,5Z)-cycloocta-1,5-diene;dibromopalladium |
| InChIKey | VDWGPWKGFNEZFD-PHFPKPIQSA-L |
| INCHI | 1S/C8H12.2BrH.Pd/c1-2-4-6-8-7-5-3-1;;;/h1-2,7-8H,3-6H2;2*1H;/q;;;+2/p-2/b2-1-,8-7-;;; |
| Isómeros SMILES | C1/C=C\CC/C=C\C1.Br[Pd]Br |
| PubChem CID | 11187970 |
| Peso molecular | 374.41 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic salts |
| Clase | Organic metal salts |
| Subclass | Organic metal bromide salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organic metal bromide salts |
| Alternative Parents | Organic transition metal salts Organic bromide salts Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Organic metal bromide salt - Organic transition metal salt - Hydrocarbon derivative - Organic bromide salt - Aliphatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as organic metal bromide salts. These are organic metal salts containing a bromine atom in its ionic form. |
| External Descriptors | Not available |
| Punto de fusión (°C) | 201-205 °C |
|---|---|
| Peso molecular | 374.410 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 373.832 Da |
| Monoisotopic Mass | 371.834 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 75.400 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 2 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 2 |
| Covalently-Bonded Unit Count | 2 |