≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCOC(=O)C(=CNC1=NC=C(C=C1)I)C(=O)OCC |
|---|---|
| IUPAC Name | diethyl 2-[[(5-iodopyridin-2-yl)amino]methylidene]propanedioate |
| InChIKey | KNZLYYCXHDSLIT-UHFFFAOYSA-N |
| INCHI | 1S/C13H15IN2O4/c1-3-19-12(17)10(13(18)20-4-2)8-16-11-6-5-9(14)7-15-11/h5-8H,3-4H2,1-2H3,(H,15,16) |
| Isómeros SMILES | CCOC(=O)C(=CNC1=NC=C(C=C1)I)C(=O)OCC |
| PubChem CID | 4313692 |
| Peso molecular | 390.18 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Pyridines and derivatives |
| Subclass | Aminopyridines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminopyridines and derivatives |
| Alternative Parents | Secondary alkylarylamines Imidolactams Dicarboxylic acids and derivatives Aryl iodides Vinylogous amides Heteroaromatic compounds Enoate esters Amino acids and derivatives Enamines Azacyclic compounds Organopnictogen compounds Organoiodides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aminopyridine - Secondary aliphatic/aromatic amine - Aryl halide - Aryl iodide - Dicarboxylic acid or derivatives - Imidolactam - Heteroaromatic compound - Vinylogous amide - Alpha,beta-unsaturated carboxylic ester - Enoate ester - Amino acid or derivatives - Carboxylic acid ester - Carboxylic acid derivative - Azacycle - Enamine - Secondary amine - Organohalogen compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Amine - Carbonyl group - Organic oxide - Organopnictogen compound - Organoiodide - Organonitrogen compound - Organooxygen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as aminopyridines and derivatives. These are organic heterocyclic compounds containing an amino group attached to a pyridine ring. |
| External Descriptors | Not available |
| Peso molecular | 390.170 g/mol |
|---|---|
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 8 |
| Exact Mass | 390.008 Da |
| Monoisotopic Mass | 390.008 Da |
| Topological Polar Surface Area | 77.500 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 353.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![Diethyl 2-{[(5-iodo-2-pyridinyl)amino]methylene}malonate - ≥90% , CAS No.865658-80-6](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)