Determine the necessary mass, volume, or concentration for preparing a solution.
10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Dihydroxyfumaric acid is a known generator of superoxide anions and by hydroxyl free radicals. Dihydroxyfumarate exposure can cause insulin inhibitory effects. It can spontaneously convert to hydroxypyruvate or to oxaloglycolate;
| Sonrisas canónicas | C(=C(C(=O)O)O)(C(=O)O)O.O |
|---|---|
| IUPAC Name | (E)-2,3-dihydroxybut-2-enedioic acid;hydrate |
| InChIKey | DDYHTXQJGPQZGN-TYYBGVCCSA-N |
| INCHI | 1S/C4H4O6.H2O/c5-1(3(7)8)2(6)4(9)10;/h5-6H,(H,7,8)(H,9,10);1H2/b2-1+; |
| Isómeros SMILES | C(=C(/C(=O)O)\O)(\C(=O)O)/O.O |
| WGK Alemania | 3 |
| CAS alternativo | 133-38-0 |
| Peso molecular | 148.07 (anhydrous basis) |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Clase | Fatty Acyls |
| Subclass | Fatty acids and conjugates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Hydroxy fatty acids |
| Alternative Parents | Unsaturated fatty acids Dicarboxylic acids and derivatives Vinylogous acids Enediols Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hydroxy fatty acid - Unsaturated fatty acid - Dicarboxylic acid or derivatives - Vinylogous acid - Enediol - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as hydroxy fatty acids. These are fatty acids in which the chain bears a hydroxyl group. |
| External Descriptors | Not available |
| Punto de fusión (°C) | 156°C |
|---|---|
| Peso molecular | 166.090 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 2 |
| Exact Mass | 166.011 Da |
| Monoisotopic Mass | 166.011 Da |
| Topological Polar Surface Area | 116.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 180.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 2 |
| 1. Min Zhou, Wei Wu, Hong Pu, Feng Chen, Chaofan Yi, Yuande Long. (2024) A drug–excipient interaction impurity of bromhexine hydrochloride injection: Structure and formation mechanism elucidation. JOURNAL OF PHARMACEUTICAL AND BIOMEDICAL ANALYSIS, [PMID:38850847] [10.1016/j.jpba.2024.116256] |