Determine the necessary mass, volume, or concentration for preparing a solution.
Initial melting point≥65℃,crystal for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature,Desiccated Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(C)CN(CC(C)C)C(=S)SSC(=S)N(CC(C)C)CC(C)C |
|---|---|
| IUPAC Name | bis(2-methylpropyl)carbamothioylsulfanyl N,N-bis(2-methylpropyl)carbamodithioate |
| InChIKey | QOTYLQBPNZRMNL-UHFFFAOYSA-N |
| INCHI | 1S/C18H36N2S4/c1-13(2)9-19(10-14(3)4)17(21)23-24-18(22)20(11-15(5)6)12-16(7)8/h13-16H,9-12H2,1-8H3 |
| Isómeros SMILES | CC(C)CN(CC(C)C)C(=S)SSC(=S)N(CC(C)C)CC(C)C |
| PubChem CID | 76470 |
| Peso molecular | 408.75 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines |
| Direct Parent | Thiuram disulfides |
| Alternative Parents | Organic disulfides Sulfenyl compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Thiuram disulfide - Organic disulfide - Sulfenyl compound - Organopnictogen compound - Hydrocarbon derivative - Organosulfur compound - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as thiuram disulfides. These are organic disulfides that have the general structural formula RN(R')C(=S)SSC(=S)N(R\")R\"', where R-R\"'=alkyl groups. |
| External Descriptors | Not available |
| Peso molecular | 408.800 g/mol |
|---|---|
| XLogP3 | 7.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 11 |
| Exact Mass | 408.176 Da |
| Monoisotopic Mass | 408.176 Da |
| Topological Polar Surface Area | 121.000 Ų |
| Heavy Atom Count | 24 |
| Formal Charge | 0 |
| Complexity | 325.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |