Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | COC(=O)C1CC(N(CC1=O)C(=O)C2=CC=CC=C2)C(=O)OC |
|---|---|
| IUPAC Name | dimethyl 1-benzoyl-5-oxopiperidine-2,4-dicarboxylate |
| InChIKey | KQXKRUDATDKFEL-UHFFFAOYSA-N |
| INCHI | 1S/C16H17NO6/c1-22-15(20)11-8-12(16(21)23-2)17(9-13(11)18)14(19)10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3 |
| Isómeros SMILES | COC(=O)C1CC(N(CC1=O)C(=O)C2=CC=CC=C2)C(=O)OC |
| PubChem CID | 66521689 |
| Peso molecular | 319.32 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzoyl derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1-benzoylpiperidines |
| Alternative Parents | N-benzoylpiperidines Alpha amino acid esters Piperidinecarboxylic acids Benzamides Piperidinones Dicarboxylic acids and derivatives 1,3-dicarbonyl compounds Tertiary carboxylic acid amides Methyl esters Tertiary amines Cyclic ketones Azacyclic compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 1-benzoylpiperidine - N-benzoylpiperidine - Alpha-amino acid ester - Alpha-amino acid or derivatives - Benzamide - Benzoic acid or derivatives - N-acyl-piperidine - Piperidinecarboxylic acid - Piperidinone - Dicarboxylic acid or derivatives - 1,3-dicarbonyl compound - Piperidine - Methyl ester - Tertiary carboxylic acid amide - Amino acid or derivatives - Carboxamide group - Carboxylic acid ester - Ketone - Cyclic ketone - Tertiary amine - Azacycle - Carboxylic acid derivative - Organoheterocyclic compound - Amine - Organic oxygen compound - Carbonyl group - Hydrocarbon derivative - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Organic oxide - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as 1-benzoylpiperidines. These are compounds containing a piperidine ring substituted at the 1-position with a benzoyl group. |
| External Descriptors | Not available |
| Peso molecular | 319.310 g/mol |
|---|---|
| XLogP3 | 1.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Exact Mass | 319.106 Da |
| Monoisotopic Mass | 319.106 Da |
| Topological Polar Surface Area | 90.000 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 497.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |