≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | COC(=O)CC1=CC=C(C=C1)CNCC2=CC=C(C=C2)CC(=O)OC.Cl |
|---|---|
| IUPAC Name | methyl 2-[4-[[[4-(2-methoxy-2-oxoethyl)phenyl]methylamino]methyl]phenyl]acetate;hydrochloride |
| InChIKey | UXWZVKZAHZTZLX-UHFFFAOYSA-N |
| INCHI | 1S/C20H23NO4.ClH/c1-24-19(22)11-15-3-7-17(8-4-15)13-21-14-18-9-5-16(6-10-18)12-20(23)25-2;/h3-10,21H,11-14H2,1-2H3;1H |
| Isómeros SMILES | COC(=O)CC1=CC=C(C=C1)CNCC2=CC=C(C=C2)CC(=O)OC.Cl |
| PubChem CID | 91667868 |
| Peso molecular | 377.9 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Phenylmethylamines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylmethylamines |
| Alternative Parents | Benzylamines Aralkylamines Dicarboxylic acids and derivatives Methyl esters Amino acids and derivatives Dialkylamines Organic oxides Hydrochlorides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzylamine - Phenylmethylamine - Aralkylamine - Dicarboxylic acid or derivatives - Methyl ester - Amino acid or derivatives - Carboxylic acid ester - Carboxylic acid derivative - Secondary aliphatic amine - Secondary amine - Amine - Organonitrogen compound - Organooxygen compound - Hydrochloride - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organic oxygen compound - Organic nitrogen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenylmethylamines. These are compounds containing a phenylmethtylamine moiety, which consists of a phenyl group substituted by an methanamine. |
| External Descriptors | Not available |
| Peso molecular | 377.900 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 10 |
| Exact Mass | 377.139 Da |
| Monoisotopic Mass | 377.139 Da |
| Topological Polar Surface Area | 64.599 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 372.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
