Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504759345 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504759345 |
| Sonrisas canónicas | COP(=O)(CC(=O)COC1=CC=CC=C1)OC |
| IUPAC Name | 1-dimethoxyphosphoryl-3-phenoxypropan-2-one |
| InChIKey | NQTSTBMCCAVWOS-UHFFFAOYSA-N |
| INCHI | 1S/C11H15O5P/c1-14-17(13,15-2)9-10(12)8-16-11-6-4-3-5-7-11/h3-7H,8-9H2,1-2H3 |
| Isómeros SMILES | COP(=O)(CC(=O)COC1=CC=CC=C1)OC |
| Peso molecular | 258.21 |
| Reaxy-Rn | 2055367 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2055367&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Phenol ethers |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol ethers |
| Alternative Parents | Phenoxy compounds Dialkyl alkylphosphonates Alkyl aryl ethers Phosphonic acid esters Ketones Organopnictogen compounds Organophosphorus compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Phenol ether - Alkyl aryl ether - Dialkyl alkylphosphonate - Phosphonic acid diester - Monocyclic benzene moiety - Phosphonic acid ester - Organophosphonic acid derivative - Ketone - Ether - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Carbonyl group - Organopnictogen compound - Organophosphorus compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. |
| External Descriptors | Not available |
| Sensibilidad | Light sensitive;Air sensitive |
|---|---|
| Índice de refracción | 1.52 |
| Punto de ebullición (°C) | 175 °C/0.5 mmHg |
| Peso molecular | 258.209 g/mol |
| XLogP3 | 0.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 7 |
| Exact Mass | 258.066 Da |
| Monoisotopic Mass | 258.066 Da |
| Topological Polar Surface Area | 61.800 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 278.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |