Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%,≥99 atom% D for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Conservar a 2-8°C Ships Hielo húmedo Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | COC(=O)OC |
|---|---|
| IUPAC Name | bis(trideuteriomethyl) carbonate |
| InChIKey | IEJIGPNLZYLLBP-WFGJKAKNSA-N |
| INCHI | 1S/C3H6O3/c1-5-3(4)6-2/h1-2H3/i1D3,2D3 |
| Isómeros SMILES | [2H]C([2H])([2H])OC(=O)OC([2H])([2H])[2H] |
| CAS alternativo | 616-38-6(unlabelled) |
| Número ONU | UN 1161 |
| Grupo de embalaje | II |
| Peso molecular | 96.11 |
| Reaxy-Rn | 635821 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=635821&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Organic carbonic acids and derivatives |
| Subclass | Carbonic acid diesters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carbonic acid diesters |
| Alternative Parents | Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Carbonic acid diester - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as carbonic acid diesters. These are compounds comprising the carbonic acid diester functional group. |
| External Descriptors | Not available |
| Punto de inflamación (°F) | 60.8 °F |
|---|---|
| Punto de inflamación (°C) | 16 °C |
| Punto de ebullición (°C) | 90 °C |
| Punto de fusión (°C) | 2-4 °C |
| Peso molecular | 96.110 g/mol |
| XLogP3 | 0.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 96.0694 Da |
| Monoisotopic Mass | 96.0694 Da |
| Topological Polar Surface Area | 35.500 Ų |
| Heavy Atom Count | 6 |
| Formal Charge | 0 |
| Complexity | 44.000 |
| Isotope Atom Count | 6 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |