Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged,Desiccated Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCCN(CCC)CCC1=CC(=C(C=C1)O)O.Br |
|---|---|
| IUPAC Name | 4-[2-(dipropylamino)ethyl]benzene-1,2-diol;hydrobromide |
| InChIKey | QAXMCYJNFHCJFB-UHFFFAOYSA-N |
| INCHI | 1S/C14H23NO2.BrH/c1-3-8-15(9-4-2)10-7-12-5-6-13(16)14(17)11-12;/h5-6,11,16-17H,3-4,7-10H2,1-2H3;1H |
| Isómeros SMILES | CCCN(CCC)CCC1=CC(=C(C=C1)O)O.Br |
| CAS alternativo | 65273-66-7 |
| PubChem CID | 11957536 |
| Términos de entrada MeSH | DPDA;N,N-di-n-propyldopamine;N,N-di-n-propyldopamine hydrobromide;N,N-di-n-propyldopamine hydrochloride;N,N-di-n-propyldopamine hydroiodide |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Phenols |
| Subclass | Benzenediols |
| Intermediate Tree Nodes | Catechols |
| Direct Parent | Catecholamines and derivatives |
| Alternative Parents | Phenethylamines Aralkylamines 1-hydroxy-4-unsubstituted benzenoids 1-hydroxy-2-unsubstituted benzenoids Trialkylamines Organooxygen compounds Hydrocarbon derivatives Hydrobromides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Catecholamine - Phenethylamine - 1-hydroxy-4-unsubstituted benzenoid - 1-hydroxy-2-unsubstituted benzenoid - Aralkylamine - Monocyclic benzene moiety - Tertiary amine - Tertiary aliphatic amine - Amine - Hydrobromide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as catecholamines and derivatives. These are compounds containing 4-(2-Aminoethyl)pyrocatechol [4-(2-aminoethyl)benzene-1,2-diol] or a derivative thereof formed by substitution. |
| External Descriptors | Not available |
| Peso molecular | 318.250 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 7 |
| Exact Mass | 317.099 Da |
| Monoisotopic Mass | 317.099 Da |
| Topological Polar Surface Area | 43.700 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 193.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |