Determine the necessary mass, volume, or concentration for preparing a solution.
Disponible para pedir
GRADE & PURITY ≥98%
Synonyms
2-(3-(Dimethylamino)-1-methoxyallylidene)malononitrile
Storage
Store at 2-8°C
Shipped In
Wet ice
| Pubchem Sid | 504763946 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504763946 |
| Sonrisas canónicas | CN(C)C=CC(=C(C#N)C#N)OC |
| IUPAC Name | 2-[(E)-3-(dimethylamino)-1-methoxyprop-2-enylidene]propanedinitrile |
| InChIKey | YEUYKZLMAGACBX-SNAWJCMRSA-N |
| INCHI | 1S/C9H11N3O/c1-12(2)5-4-9(13-3)8(6-10)7-11/h4-5H,1-3H3/b5-4+ |
| Isómeros SMILES | CN(C)/C=C/C(=C(C#N)C#N)OC |
| Peso molecular | 177.20 |
| Reaxy-Rn | 6191979 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=6191979&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines |
| Direct Parent | Trialkylamines |
| Alternative Parents | Nitriles Enamines Allylamines Organooxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tertiary aliphatic amine - Allylamine - Nitrile - Carbonitrile - Enamine - Organic oxygen compound - Cyanide - Hydrocarbon derivative - Organooxygen compound - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as trialkylamines. These are organic compounds containing a trialkylamine group, characterized by exactly three alkyl groups bonded to the amino nitrogen. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
| Certificate of Analysis | Jun 09, 2026 | E188682 | |
| Certificate of Analysis | Jun 09, 2026 | E188682 | |
| Certificate of Analysis | Jun 09, 2026 | E188682 | |
| Certificate of Analysis | Jun 09, 2026 | E188682 | |
| Certificate of Analysis | Jun 09, 2026 | E188682 | |
| Certificate of Analysis | Jun 09, 2026 | E188682 | |
| Certificate of Analysis | Jun 09, 2026 | E188682 | |
| Certificate of Analysis | Jun 09, 2026 | E188682 |
| Peso molecular | 177.200 g/mol |
|---|---|
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 177.09 Da |
| Monoisotopic Mass | 177.09 Da |
| Topological Polar Surface Area | 60.100 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 303.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |